About CID 119079267
CID 119079267 (PubChem CID 119079267) has the molecular formula C24H44BN2P2
and a molecular weight of 433.39 g/mol.
Molecular Properties
| Compound Name | CID 119079267 |
| PubChem CID | 119079267 |
| Molecular Formula | C24H44BN2P2 |
| Molecular Weight | 433.39 g/mol |
| Exact Mass | 433.31 |
| IUPAC Name | — |
| SMILES | CC(C)(C)P(CN1[B]N(CP(C(C)(C)C)C(C)(C)C)c2ccccc21)C(C)(C)C |
| InChI | InChI=1S/C24H44BN2P2/c1-21(2,3)28(22(4,5)6)17-26-19-15-13-14-16-20(19)27(25-26)18-29(23(7,8)9)24(10,11)12/h13-16H,17-18H2,1-12H3 |
| InChIKey | POWSVVFFNCVAOG-UHFFFAOYSA-N |
| XLogP | 7.92 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 433.39 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 119079267 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 119079267?
The IUPAC name of CID 119079267 (CID 119079267) is not available.
What is the SMILES notation for CID 119079267?
The canonical SMILES for CID 119079267 is CC(C)(C)P(CN1[B]N(CP(C(C)(C)C)C(C)(C)C)c2ccccc21)C(C)(C)C.
What is the InChIKey of CID 119079267?
The InChIKey is POWSVVFFNCVAOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H44BN2P2/c1-21(2,3)28(22(4,5)6)17-26-19-15-13-14-16-20(19)27(25-26)18-29(23(7,8)9)24(10,11)12/h13-16H,17-18H2,1-12H3.
What are the key properties of CID 119079267?
CID 119079267 has a molecular weight of 433.39 g/mol, XLogP of 7.92, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 119079267 is sourced from PubChem (CID 119079267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).