About sodium 6-(dimethylamino)-4-sulfanylidene-1H-1,3,5-triazine-2-thiolate
sodium 6-(dimethylamino)-4-sulfanylidene-1H-1,3,5-triazine-2-thiolate (PubChem CID 119079291) has the molecular formula C5H7N4NaS2
and a molecular weight of 210.26 g/mol. Its IUPAC name is sodium 6-(dimethylamino)-4-sulfanylidene-1H-1,3,5-triazine-2-thiolate.
Molecular Properties
| Compound Name | sodium 6-(dimethylamino)-4-sulfanylidene-1H-1,3,5-triazine-2-thiolate |
| PubChem CID | 119079291 |
| Molecular Formula | C5H7N4NaS2 |
| Molecular Weight | 210.26 g/mol |
| Exact Mass | 210.00 |
| IUPAC Name | sodium 6-(dimethylamino)-4-sulfanylidene-1H-1,3,5-triazine-2-thiolate |
| SMILES | CN(C)c1nc(=S)nc([S-])[nH]1.[Na+] |
| InChI | InChI=1S/C5H8N4S2.Na/c1-9(2)3-6-4(10)8-5(11)7-3;/h1-2H3,(H2,6,7,8,10,11);/q;+1/p-1 |
| InChIKey | XNXQODDOBONUSM-UHFFFAOYSA-M |
| XLogP | -2.49 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.26 |
| LogP ≤ 5 | -2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze sodium 6-(dimethylamino)-4-sulfanylidene-1H-1,3,5-triazine-2-thiolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 6-(dimethylamino)-4-sulfanylidene-1H-1,3,5-triazine-2-thiolate?
The IUPAC name of sodium 6-(dimethylamino)-4-sulfanylidene-1H-1,3,5-triazine-2-thiolate (CID 119079291) is sodium 6-(dimethylamino)-4-sulfanylidene-1H-1,3,5-triazine-2-thiolate.
What is the SMILES notation for sodium 6-(dimethylamino)-4-sulfanylidene-1H-1,3,5-triazine-2-thiolate?
The canonical SMILES for sodium 6-(dimethylamino)-4-sulfanylidene-1H-1,3,5-triazine-2-thiolate is CN(C)c1nc(=S)nc([S-])[nH]1.[Na+].
What is the InChIKey of sodium 6-(dimethylamino)-4-sulfanylidene-1H-1,3,5-triazine-2-thiolate?
The InChIKey is XNXQODDOBONUSM-UHFFFAOYSA-M. The full InChI is InChI=1S/C5H8N4S2.Na/c1-9(2)3-6-4(10)8-5(11)7-3;/h1-2H3,(H2,6,7,8,10,11);/q;+1/p-1.
What are the key properties of sodium 6-(dimethylamino)-4-sulfanylidene-1H-1,3,5-triazine-2-thiolate?
sodium 6-(dimethylamino)-4-sulfanylidene-1H-1,3,5-triazine-2-thiolate has a molecular weight of 210.26 g/mol, XLogP of -2.49, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 6-(dimethylamino)-4-sulfanylidene-1H-1,3,5-triazine-2-thiolate is sourced from PubChem (CID 119079291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).