C15H15N3O3 — CID 119079430
(1S,2R,8S,9R,10R,11R,12S,13R,15R,17R)-5-methyl-16-oxa-3,5,7-triazaoctacyclo[9.7.0.01,13.02,10.03,7.08,13.09,12.015,17]octadecane-4,6-dione (PubChem CID 119079430) has the molecular formula C15H15N3O3 and a molecular weight of 285.30 g/mol. Its IUPAC name is (1S,2R,8S,9R,10R,11R,12S,13R,15R,17R)-5-methyl-16-oxa-3,5,7-triazaoctacyclo[9.7.0.01,13.02,10.03,7.08,13.09,12.015,17]octadecane-4,6-dione.
| Compound Name | (1S,2R,8S,9R,10R,11R,12S,13R,15R,17R)-5-methyl-16-oxa-3,5,7-triazaoctacyclo[9.7.0.01,13.02,10.03,7.08,13.09,12.015,17]octadecane-4,6-dione |
|---|---|
| PubChem CID | 119079430 |
| Molecular Formula | C15H15N3O3 |
| Molecular Weight | 285.30 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | (1S,2R,8S,9R,10R,11R,12S,13R,15R,17R)-5-methyl-16-oxa-3,5,7-triazaoctacyclo[9.7.0.01,13.02,10.03,7.08,13.09,12.015,17]octadecane-4,6-dione |
| SMILES | Cn1c(=O)n2n(c1=O)[C@@H]1[C@H]3[C@H]4[C@@H]5[C@H]3[C@]13C[C@H]1O[C@@H]1C[C@@]53[C@H]42 |
| InChI | InChI=1S/C15H15N3O3/c1-16-12(19)17-10-6-7-9-8(6)14(10)2-4-5(21-4)3-15(9,14)11(7)18(17)13(16)20/h4-11H,2-3H2,1H3/t4-,5-,6+,7+,8-,9+,10+,11-,14+,15-/m1/s1 |
| InChIKey | RKBOUMTZDCRIEY-PCKIZCAOSA-N |
| XLogP | -0.50 |
| TPSA | 61.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.30 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|