C26H20N2 — CID 119079459
(1S,4R,5R,6R,7S,8R)-3,4,5-triphenyl-9,10-diazapentacyclo[4.4.0.02,8.03,5.04,7]dec-9-ene (PubChem CID 119079459) has the molecular formula C26H20N2 and a molecular weight of 360.46 g/mol. Its IUPAC name is (1S,4R,5R,6R,7S,8R)-3,4,5-triphenyl-9,10-diazapentacyclo[4.4.0.02,8.03,5.04,7]dec-9-ene.
| Compound Name | (1S,4R,5R,6R,7S,8R)-3,4,5-triphenyl-9,10-diazapentacyclo[4.4.0.02,8.03,5.04,7]dec-9-ene |
|---|---|
| PubChem CID | 119079459 |
| Molecular Formula | C26H20N2 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | (1S,4R,5R,6R,7S,8R)-3,4,5-triphenyl-9,10-diazapentacyclo[4.4.0.02,8.03,5.04,7]dec-9-ene |
| SMILES | c1ccc(C23C4[C@H]5N=N[C@@H]4[C@H]4[C@@H]5[C@@]2(c2ccccc2)[C@]43c2ccccc2)cc1 |
| InChI | InChI=1S/C26H20N2/c1-4-10-16(11-5-1)24-19-20-23-21(22(19)27-28-23)26(24,18-14-8-3-9-15-18)25(20,24)17-12-6-2-7-13-17/h1-15,19-23H/t19-,20+,21?,22-,23+,24-,25-,26?/m0/s1 |
| InChIKey | CFTZWOUSJQYYFS-YCZHSYNJSA-N |
| XLogP | 4.91 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |