About CID 119080079
CID 119080079 (PubChem CID 119080079) has the molecular formula C20H15SSi
and a molecular weight of 315.49 g/mol.
Molecular Properties
| Compound Name | CID 119080079 |
| PubChem CID | 119080079 |
| Molecular Formula | C20H15SSi |
| Molecular Weight | 315.49 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | — |
| SMILES | c1ccc([Si](c2cccs2)c2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C20H15SSi/c1-2-10-17(11-3-1)22(20-14-7-15-21-20)19-13-6-9-16-8-4-5-12-18(16)19/h1-15H |
| InChIKey | NMVGEERYYVYHPO-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.49 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 119080079 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 119080079?
The IUPAC name of CID 119080079 (CID 119080079) is not available.
What is the SMILES notation for CID 119080079?
The canonical SMILES for CID 119080079 is c1ccc([Si](c2cccs2)c2cccc3ccccc23)cc1.
What is the InChIKey of CID 119080079?
The InChIKey is NMVGEERYYVYHPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15SSi/c1-2-10-17(11-3-1)22(20-14-7-15-21-20)19-13-6-9-16-8-4-5-12-18(16)19/h1-15H.
What are the key properties of CID 119080079?
CID 119080079 has a molecular weight of 315.49 g/mol, XLogP of 3.42, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 119080079 is sourced from PubChem (CID 119080079), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).