C22H23F3N6O9S — CID 119081241
[(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl N-[4-oxo-4-[2-(2,2,2-trifluoro-1-hydroxyethyl)phenyl]butanoyl]sulfamate (PubChem CID 119081241) has the molecular formula C22H23F3N6O9S and a molecular weight of 604.52 g/mol. Its IUPAC name is [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl N-[4-oxo-4-[2-(2,2,2-trifluoro-1-hydroxyethyl)phenyl]butanoyl]sulfamate.
| Compound Name | [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl N-[4-oxo-4-[2-(2,2,2-trifluoro-1-hydroxyethyl)phenyl]butanoyl]sulfamate |
|---|---|
| PubChem CID | 119081241 |
| Molecular Formula | C22H23F3N6O9S |
| Molecular Weight | 604.52 g/mol |
| Exact Mass | 604.12 |
| IUPAC Name | [(2R,3S,4R,5R)-5-(6-aminopurin-9-yl)-3,4-dihydroxyoxolan-2-yl]methyl N-[4-oxo-4-[2-(2,2,2-trifluoro-1-hydroxyethyl)phenyl]butanoyl]sulfamate |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](COS(=O)(=O)NC(=O)CCC(=O)c2ccccc2C(O)C(F)(F)F)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C22H23F3N6O9S/c23-22(24,25)18(36)11-4-2-1-3-10(11)12(32)5-6-14(33)30-41(37,38)39-7-13-16(34)17(35)21(40-13)31-9-29-15-19(26)27-8-28-20(15)31/h1-4,8-9,13,16-18,21,34-36H,5-7H2,(H,30,33)(H2,26,27,28)/t13-,16-,17-,18?,21-/m1/s1 |
| InChIKey | DAEJMFLPLFDCPH-BQHNSYQGSA-N |
| XLogP | -0.34 |
| TPSA | 229.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.52 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 14 |