C6H6F3NO2S — CID 119082012
2,2,2-trifluoro-1-(4-methyl-1,3-thiazol-2-yl)ethane-1,1-diol (PubChem CID 119082012) has the molecular formula C6H6F3NO2S and a molecular weight of 213.18 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-(4-methyl-1,3-thiazol-2-yl)ethane-1,1-diol.
| Compound Name | 2,2,2-trifluoro-1-(4-methyl-1,3-thiazol-2-yl)ethane-1,1-diol |
|---|---|
| PubChem CID | 119082012 |
| Molecular Formula | C6H6F3NO2S |
| Molecular Weight | 213.18 g/mol |
| Exact Mass | 213.01 |
| IUPAC Name | 2,2,2-trifluoro-1-(4-methyl-1,3-thiazol-2-yl)ethane-1,1-diol |
| SMILES | Cc1csc(C(O)(O)C(F)(F)F)n1 |
| InChI | InChI=1S/C6H6F3NO2S/c1-3-2-13-4(10-3)5(11,12)6(7,8)9/h2,11-12H,1H3 |
| InChIKey | NHAOCWNEJQKKHQ-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 53.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.18 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|