C8H11NO2 — CID 119082202
4-(3-hydroxypropyl)-1H-pyridin-2-one (PubChem CID 119082202) has the molecular formula C8H11NO2 and a molecular weight of 153.18 g/mol. Its IUPAC name is 4-(3-hydroxypropyl)-1H-pyridin-2-one.
| Compound Name | 4-(3-hydroxypropyl)-1H-pyridin-2-one |
|---|---|
| PubChem CID | 119082202 |
| Molecular Formula | C8H11NO2 |
| Molecular Weight | 153.18 g/mol |
| Exact Mass | 153.08 |
| IUPAC Name | 4-(3-hydroxypropyl)-1H-pyridin-2-one |
| SMILES | O=c1cc(CCCO)cc[nH]1 |
| InChI | InChI=1S/C8H11NO2/c10-5-1-2-7-3-4-9-8(11)6-7/h3-4,6,10H,1-2,5H2,(H,9,11) |
| InChIKey | ORHNXBHLCXDCFQ-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.18 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |