About 5-methoxy-3H-indazole
5-methoxy-3H-indazole (PubChem CID 119082397) has the molecular formula C8H8N2O
and a molecular weight of 148.16 g/mol. Its IUPAC name is 5-methoxy-3H-indazole.
Molecular Properties
| Compound Name | 5-methoxy-3H-indazole |
| PubChem CID | 119082397 |
| Molecular Formula | C8H8N2O |
| Molecular Weight | 148.16 g/mol |
| Exact Mass | 148.06 |
| IUPAC Name | 5-methoxy-3H-indazole |
| SMILES | COc1ccc2c(c1)CN=N2 |
| InChI | InChI=1S/C8H8N2O/c1-11-7-2-3-8-6(4-7)5-9-10-8/h2-4H,5H2,1H3 |
| InChIKey | FPULHKLIBIODRY-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.16 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-methoxy-3H-indazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methoxy-3H-indazole?
The IUPAC name of 5-methoxy-3H-indazole (CID 119082397) is 5-methoxy-3H-indazole.
What is the SMILES notation for 5-methoxy-3H-indazole?
The canonical SMILES for 5-methoxy-3H-indazole is COc1ccc2c(c1)CN=N2.
What is the InChIKey of 5-methoxy-3H-indazole?
The InChIKey is FPULHKLIBIODRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2O/c1-11-7-2-3-8-6(4-7)5-9-10-8/h2-4H,5H2,1H3.
What are the key properties of 5-methoxy-3H-indazole?
5-methoxy-3H-indazole has a molecular weight of 148.16 g/mol, XLogP of 2.29, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methoxy-3H-indazole is sourced from PubChem (CID 119082397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).