C9H9NO2 — CID 119083461
(5-methyl-1,2-benzoxazol-3-yl)methanol (PubChem CID 119083461) has the molecular formula C9H9NO2 and a molecular weight of 163.18 g/mol. Its IUPAC name is (5-methyl-1,2-benzoxazol-3-yl)methanol.
| Compound Name | (5-methyl-1,2-benzoxazol-3-yl)methanol |
|---|---|
| PubChem CID | 119083461 |
| Molecular Formula | C9H9NO2 |
| Molecular Weight | 163.18 g/mol |
| Exact Mass | 163.06 |
| IUPAC Name | (5-methyl-1,2-benzoxazol-3-yl)methanol |
| SMILES | Cc1ccc2onc(CO)c2c1 |
| InChI | InChI=1S/C9H9NO2/c1-6-2-3-9-7(4-6)8(5-11)10-12-9/h2-4,11H,5H2,1H3 |
| InChIKey | LWROILPIWGTVOY-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.18 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |