About 5-(3,4-dihydronaphthalen-2-yl)-1,3-oxazole
5-(3,4-dihydronaphthalen-2-yl)-1,3-oxazole (PubChem CID 119083765) has the molecular formula C13H11NO
and a molecular weight of 197.24 g/mol. Its IUPAC name is 5-(3,4-dihydronaphthalen-2-yl)-1,3-oxazole.
Molecular Properties
| Compound Name | 5-(3,4-dihydronaphthalen-2-yl)-1,3-oxazole |
| PubChem CID | 119083765 |
| Molecular Formula | C13H11NO |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.08 |
| IUPAC Name | 5-(3,4-dihydronaphthalen-2-yl)-1,3-oxazole |
| SMILES | C1=C(c2cnco2)CCc2ccccc21 |
| InChI | InChI=1S/C13H11NO/c1-2-4-11-7-12(6-5-10(11)3-1)13-8-14-9-15-13/h1-4,7-9H,5-6H2 |
| InChIKey | DYJVOAVHNKTURB-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-(3,4-dihydronaphthalen-2-yl)-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(3,4-dihydronaphthalen-2-yl)-1,3-oxazole?
The IUPAC name of 5-(3,4-dihydronaphthalen-2-yl)-1,3-oxazole (CID 119083765) is 5-(3,4-dihydronaphthalen-2-yl)-1,3-oxazole.
What is the SMILES notation for 5-(3,4-dihydronaphthalen-2-yl)-1,3-oxazole?
The canonical SMILES for 5-(3,4-dihydronaphthalen-2-yl)-1,3-oxazole is C1=C(c2cnco2)CCc2ccccc21.
What is the InChIKey of 5-(3,4-dihydronaphthalen-2-yl)-1,3-oxazole?
The InChIKey is DYJVOAVHNKTURB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11NO/c1-2-4-11-7-12(6-5-10(11)3-1)13-8-14-9-15-13/h1-4,7-9H,5-6H2.
What are the key properties of 5-(3,4-dihydronaphthalen-2-yl)-1,3-oxazole?
5-(3,4-dihydronaphthalen-2-yl)-1,3-oxazole has a molecular weight of 197.24 g/mol, XLogP of 3.16, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(3,4-dihydronaphthalen-2-yl)-1,3-oxazole is sourced from PubChem (CID 119083765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).