About 2-(1-chloro-2,2,2-trifluoroethyl)sulfanyl-1H-imidazole
2-(1-chloro-2,2,2-trifluoroethyl)sulfanyl-1H-imidazole (PubChem CID 119083852) has the molecular formula C5H4ClF3N2S
and a molecular weight of 216.62 g/mol. Its IUPAC name is 2-(1-chloro-2,2,2-trifluoroethyl)sulfanyl-1H-imidazole.
Molecular Properties
| Compound Name | 2-(1-chloro-2,2,2-trifluoroethyl)sulfanyl-1H-imidazole |
| PubChem CID | 119083852 |
| Molecular Formula | C5H4ClF3N2S |
| Molecular Weight | 216.62 g/mol |
| Exact Mass | 215.97 |
| IUPAC Name | 2-(1-chloro-2,2,2-trifluoroethyl)sulfanyl-1H-imidazole |
| SMILES | FC(F)(F)C(Cl)Sc1ncc[nH]1 |
| InChI | InChI=1S/C5H4ClF3N2S/c6-3(5(7,8)9)12-4-10-1-2-11-4/h1-3H,(H,10,11) |
| InChIKey | XSCXBNAFZAWDED-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.62 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-(1-chloro-2,2,2-trifluoroethyl)sulfanyl-1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-chloro-2,2,2-trifluoroethyl)sulfanyl-1H-imidazole?
The IUPAC name of 2-(1-chloro-2,2,2-trifluoroethyl)sulfanyl-1H-imidazole (CID 119083852) is 2-(1-chloro-2,2,2-trifluoroethyl)sulfanyl-1H-imidazole.
What is the SMILES notation for 2-(1-chloro-2,2,2-trifluoroethyl)sulfanyl-1H-imidazole?
The canonical SMILES for 2-(1-chloro-2,2,2-trifluoroethyl)sulfanyl-1H-imidazole is FC(F)(F)C(Cl)Sc1ncc[nH]1.
What is the InChIKey of 2-(1-chloro-2,2,2-trifluoroethyl)sulfanyl-1H-imidazole?
The InChIKey is XSCXBNAFZAWDED-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4ClF3N2S/c6-3(5(7,8)9)12-4-10-1-2-11-4/h1-3H,(H,10,11).
What are the key properties of 2-(1-chloro-2,2,2-trifluoroethyl)sulfanyl-1H-imidazole?
2-(1-chloro-2,2,2-trifluoroethyl)sulfanyl-1H-imidazole has a molecular weight of 216.62 g/mol, XLogP of 2.63, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-chloro-2,2,2-trifluoroethyl)sulfanyl-1H-imidazole is sourced from PubChem (CID 119083852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).