About 6-bromo-2,4-dioxo-1H-quinazoline-8-sulfonamide
6-bromo-2,4-dioxo-1H-quinazoline-8-sulfonamide (PubChem CID 119084134) has the molecular formula C8H6BrN3O4S
and a molecular weight of 320.12 g/mol. Its IUPAC name is 6-bromo-2,4-dioxo-1H-quinazoline-8-sulfonamide.
Molecular Properties
| Compound Name | 6-bromo-2,4-dioxo-1H-quinazoline-8-sulfonamide |
| PubChem CID | 119084134 |
| Molecular Formula | C8H6BrN3O4S |
| Molecular Weight | 320.12 g/mol |
| Exact Mass | 318.93 |
| IUPAC Name | 6-bromo-2,4-dioxo-1H-quinazoline-8-sulfonamide |
| SMILES | NS(=O)(=O)c1cc(Br)cc2c(=O)[nH]c(=O)[nH]c12 |
| InChI | InChI=1S/C8H6BrN3O4S/c9-3-1-4-6(5(2-3)17(10,15)16)11-8(14)12-7(4)13/h1-2H,(H2,10,15,16)(H2,11,12,13,14) |
| InChIKey | AJZUUPRMLIRHQZ-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 125.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.12 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-bromo-2,4-dioxo-1H-quinazoline-8-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-2,4-dioxo-1H-quinazoline-8-sulfonamide?
The IUPAC name of 6-bromo-2,4-dioxo-1H-quinazoline-8-sulfonamide (CID 119084134) is 6-bromo-2,4-dioxo-1H-quinazoline-8-sulfonamide.
What is the SMILES notation for 6-bromo-2,4-dioxo-1H-quinazoline-8-sulfonamide?
The canonical SMILES for 6-bromo-2,4-dioxo-1H-quinazoline-8-sulfonamide is NS(=O)(=O)c1cc(Br)cc2c(=O)[nH]c(=O)[nH]c12.
What is the InChIKey of 6-bromo-2,4-dioxo-1H-quinazoline-8-sulfonamide?
The InChIKey is AJZUUPRMLIRHQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6BrN3O4S/c9-3-1-4-6(5(2-3)17(10,15)16)11-8(14)12-7(4)13/h1-2H,(H2,10,15,16)(H2,11,12,13,14).
What are the key properties of 6-bromo-2,4-dioxo-1H-quinazoline-8-sulfonamide?
6-bromo-2,4-dioxo-1H-quinazoline-8-sulfonamide has a molecular weight of 320.12 g/mol, XLogP of -0.37, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-2,4-dioxo-1H-quinazoline-8-sulfonamide is sourced from PubChem (CID 119084134), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).