C6H2F6N2O2 — CID 119084225
2,5-bis(trifluoromethoxy)pyrazine (PubChem CID 119084225) has the molecular formula C6H2F6N2O2 and a molecular weight of 248.08 g/mol. Its IUPAC name is 2,5-bis(trifluoromethoxy)pyrazine.
| Compound Name | 2,5-bis(trifluoromethoxy)pyrazine |
|---|---|
| PubChem CID | 119084225 |
| Molecular Formula | C6H2F6N2O2 |
| Molecular Weight | 248.08 g/mol |
| Exact Mass | 248.00 |
| IUPAC Name | 2,5-bis(trifluoromethoxy)pyrazine |
| SMILES | FC(F)(F)Oc1cnc(OC(F)(F)F)cn1 |
| InChI | InChI=1S/C6H2F6N2O2/c7-5(8,9)15-3-1-13-4(2-14-3)16-6(10,11)12/h1-2H |
| InChIKey | UDNRFDYPDVNEMX-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.08 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |