N-(3,3-difluorocyclopentyl)sulfamoyl chloride

C5H8ClF2NO2S — CID 119084418

IUPACN-(3,3-difluorocyclopentyl)sulfamoyl chloride
SMILESO=S(=O)(Cl)NC1CCC(F)(F)C1
InChIInChI=1S/C5H8ClF2NO2S/c6-12(10,11)9-4-1-2-5(7,8)3-4/h4,9H,1-3H2
InChIKeyRRVAUWKIIOXUHJ-UHFFFAOYSA-N
MW219.64 g/mol
LogP1.25
Rot. Bonds2

About N-(3,3-difluorocyclopentyl)sulfamoyl chloride

N-(3,3-difluorocyclopentyl)sulfamoyl chloride (PubChem CID 119084418) has the molecular formula C5H8ClF2NO2S and a molecular weight of 219.64 g/mol. Its IUPAC name is N-(3,3-difluorocyclopentyl)sulfamoyl chloride.

Molecular Properties

Compound NameN-(3,3-difluorocyclopentyl)sulfamoyl chloride
PubChem CID119084418
Molecular FormulaC5H8ClF2NO2S
Molecular Weight219.64 g/mol
Exact Mass218.99
IUPAC NameN-(3,3-difluorocyclopentyl)sulfamoyl chloride
SMILESO=S(=O)(Cl)NC1CCC(F)(F)C1
InChIInChI=1S/C5H8ClF2NO2S/c6-12(10,11)9-4-1-2-5(7,8)3-4/h4,9H,1-3H2
InChIKeyRRVAUWKIIOXUHJ-UHFFFAOYSA-N
XLogP1.25
TPSA46.17 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500219.64
LogP ≤ 51.25
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze N-(3,3-difluorocyclopentyl)sulfamoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of N-(3,3-difluorocyclopentyl)sulfamoyl chloride?
The IUPAC name of N-(3,3-difluorocyclopentyl)sulfamoyl chloride (CID 119084418) is N-(3,3-difluorocyclopentyl)sulfamoyl chloride.
What is the SMILES notation for N-(3,3-difluorocyclopentyl)sulfamoyl chloride?
The canonical SMILES for N-(3,3-difluorocyclopentyl)sulfamoyl chloride is O=S(=O)(Cl)NC1CCC(F)(F)C1.
What is the InChIKey of N-(3,3-difluorocyclopentyl)sulfamoyl chloride?
The InChIKey is RRVAUWKIIOXUHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8ClF2NO2S/c6-12(10,11)9-4-1-2-5(7,8)3-4/h4,9H,1-3H2.
What are the key properties of N-(3,3-difluorocyclopentyl)sulfamoyl chloride?
N-(3,3-difluorocyclopentyl)sulfamoyl chloride has a molecular weight of 219.64 g/mol, XLogP of 1.25, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,3-difluorocyclopentyl)sulfamoyl chloride is sourced from PubChem (CID 119084418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).