5-ethylfuran-2-sulfonyl chloride

C6H7ClO3S — CID 119084512

IUPAC5-ethylfuran-2-sulfonyl chloride
SMILESCCc1ccc(S(=O)(=O)Cl)o1
InChIInChI=1S/C6H7ClO3S/c1-2-5-3-4-6(10-5)11(7,8)9/h3-4H,2H2,1H3
InChIKeyIKKZOQBZEXWPLL-UHFFFAOYSA-N
MW194.64 g/mol
LogP1.77
Rot. Bonds2

About 5-ethylfuran-2-sulfonyl chloride

5-ethylfuran-2-sulfonyl chloride (PubChem CID 119084512) has the molecular formula C6H7ClO3S and a molecular weight of 194.64 g/mol. Its IUPAC name is 5-ethylfuran-2-sulfonyl chloride.

Molecular Properties

Compound Name5-ethylfuran-2-sulfonyl chloride
PubChem CID119084512
Molecular FormulaC6H7ClO3S
Molecular Weight194.64 g/mol
Exact Mass193.98
IUPAC Name5-ethylfuran-2-sulfonyl chloride
SMILESCCc1ccc(S(=O)(=O)Cl)o1
InChIInChI=1S/C6H7ClO3S/c1-2-5-3-4-6(10-5)11(7,8)9/h3-4H,2H2,1H3
InChIKeyIKKZOQBZEXWPLL-UHFFFAOYSA-N
XLogP1.77
TPSA47.28 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500194.64
LogP ≤ 51.77
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze 5-ethylfuran-2-sulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-ethylfuran-2-sulfonyl chloride?
The IUPAC name of 5-ethylfuran-2-sulfonyl chloride (CID 119084512) is 5-ethylfuran-2-sulfonyl chloride.
What is the SMILES notation for 5-ethylfuran-2-sulfonyl chloride?
The canonical SMILES for 5-ethylfuran-2-sulfonyl chloride is CCc1ccc(S(=O)(=O)Cl)o1.
What is the InChIKey of 5-ethylfuran-2-sulfonyl chloride?
The InChIKey is IKKZOQBZEXWPLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7ClO3S/c1-2-5-3-4-6(10-5)11(7,8)9/h3-4H,2H2,1H3.
What are the key properties of 5-ethylfuran-2-sulfonyl chloride?
5-ethylfuran-2-sulfonyl chloride has a molecular weight of 194.64 g/mol, XLogP of 1.77, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethylfuran-2-sulfonyl chloride is sourced from PubChem (CID 119084512), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).