furo[3,2-b]pyridin-2-ylboronic acid

C7H6BNO3 — CID 119086080

IUPACfuro[3,2-b]pyridin-2-ylboronic acid
SMILESOB(O)c1cc2ncccc2o1
InChIInChI=1S/C7H6BNO3/c10-8(11)7-4-5-6(12-7)2-1-3-9-5/h1-4,10-11H
InChIKeyBHNWTKDELHADGO-UHFFFAOYSA-N
MW162.94 g/mol
LogP-0.49
Rot. Bonds1

About furo[3,2-b]pyridin-2-ylboronic acid

furo[3,2-b]pyridin-2-ylboronic acid (PubChem CID 119086080) has the molecular formula C7H6BNO3 and a molecular weight of 162.94 g/mol. Its IUPAC name is furo[3,2-b]pyridin-2-ylboronic acid.

Molecular Properties

Compound Namefuro[3,2-b]pyridin-2-ylboronic acid
PubChem CID119086080
Molecular FormulaC7H6BNO3
Molecular Weight162.94 g/mol
Exact Mass163.04
IUPAC Namefuro[3,2-b]pyridin-2-ylboronic acid
SMILESOB(O)c1cc2ncccc2o1
InChIInChI=1S/C7H6BNO3/c10-8(11)7-4-5-6(12-7)2-1-3-9-5/h1-4,10-11H
InChIKeyBHNWTKDELHADGO-UHFFFAOYSA-N
XLogP-0.49
TPSA66.49 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500162.94
LogP ≤ 5-0.49
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze furo[3,2-b]pyridin-2-ylboronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of furo[3,2-b]pyridin-2-ylboronic acid?
The IUPAC name of furo[3,2-b]pyridin-2-ylboronic acid (CID 119086080) is furo[3,2-b]pyridin-2-ylboronic acid.
What is the SMILES notation for furo[3,2-b]pyridin-2-ylboronic acid?
The canonical SMILES for furo[3,2-b]pyridin-2-ylboronic acid is OB(O)c1cc2ncccc2o1.
What is the InChIKey of furo[3,2-b]pyridin-2-ylboronic acid?
The InChIKey is BHNWTKDELHADGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6BNO3/c10-8(11)7-4-5-6(12-7)2-1-3-9-5/h1-4,10-11H.
What are the key properties of furo[3,2-b]pyridin-2-ylboronic acid?
furo[3,2-b]pyridin-2-ylboronic acid has a molecular weight of 162.94 g/mol, XLogP of -0.49, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for furo[3,2-b]pyridin-2-ylboronic acid is sourced from PubChem (CID 119086080), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).