About 4-(2-hydroxyethyl)-1,3-thiazole-2-carboxamide
4-(2-hydroxyethyl)-1,3-thiazole-2-carboxamide (PubChem CID 119087825) has the molecular formula C6H8N2O2S
and a molecular weight of 172.21 g/mol. Its IUPAC name is 4-(2-hydroxyethyl)-1,3-thiazole-2-carboxamide.
Molecular Properties
| Compound Name | 4-(2-hydroxyethyl)-1,3-thiazole-2-carboxamide |
| PubChem CID | 119087825 |
| Molecular Formula | C6H8N2O2S |
| Molecular Weight | 172.21 g/mol |
| Exact Mass | 172.03 |
| IUPAC Name | 4-(2-hydroxyethyl)-1,3-thiazole-2-carboxamide |
| SMILES | NC(=O)c1nc(CCO)cs1 |
| InChI | InChI=1S/C6H8N2O2S/c7-5(10)6-8-4(1-2-9)3-11-6/h3,9H,1-2H2,(H2,7,10) |
| InChIKey | KFUQFCRTCLIXPZ-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.21 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(2-hydroxyethyl)-1,3-thiazole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-hydroxyethyl)-1,3-thiazole-2-carboxamide?
The IUPAC name of 4-(2-hydroxyethyl)-1,3-thiazole-2-carboxamide (CID 119087825) is 4-(2-hydroxyethyl)-1,3-thiazole-2-carboxamide.
What is the SMILES notation for 4-(2-hydroxyethyl)-1,3-thiazole-2-carboxamide?
The canonical SMILES for 4-(2-hydroxyethyl)-1,3-thiazole-2-carboxamide is NC(=O)c1nc(CCO)cs1.
What is the InChIKey of 4-(2-hydroxyethyl)-1,3-thiazole-2-carboxamide?
The InChIKey is KFUQFCRTCLIXPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2O2S/c7-5(10)6-8-4(1-2-9)3-11-6/h3,9H,1-2H2,(H2,7,10).
What are the key properties of 4-(2-hydroxyethyl)-1,3-thiazole-2-carboxamide?
4-(2-hydroxyethyl)-1,3-thiazole-2-carboxamide has a molecular weight of 172.21 g/mol, XLogP of -0.22, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-hydroxyethyl)-1,3-thiazole-2-carboxamide is sourced from PubChem (CID 119087825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).