C11H19NS — CID 119088423
8-isothiocyanato-2,6-dimethyloct-2-ene (PubChem CID 119088423) has the molecular formula C11H19NS and a molecular weight of 197.35 g/mol. Its IUPAC name is 8-isothiocyanato-2,6-dimethyloct-2-ene.
| Compound Name | 8-isothiocyanato-2,6-dimethyloct-2-ene |
|---|---|
| PubChem CID | 119088423 |
| Molecular Formula | C11H19NS |
| Molecular Weight | 197.35 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | 8-isothiocyanato-2,6-dimethyloct-2-ene |
| SMILES | CC(C)=CCCC(C)CCN=C=S |
| InChI | InChI=1S/C11H19NS/c1-10(2)5-4-6-11(3)7-8-12-9-13/h5,11H,4,6-8H2,1-3H3 |
| InChIKey | PSZUDLOACQXTDL-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.35 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|