About indolizin-3-ylmethanol
indolizin-3-ylmethanol (PubChem CID 119088496) has the molecular formula C9H9NO
and a molecular weight of 147.18 g/mol. Its IUPAC name is indolizin-3-ylmethanol.
Molecular Properties
| Compound Name | indolizin-3-ylmethanol |
| PubChem CID | 119088496 |
| Molecular Formula | C9H9NO |
| Molecular Weight | 147.18 g/mol |
| Exact Mass | 147.07 |
| IUPAC Name | indolizin-3-ylmethanol |
| SMILES | OCc1ccc2ccccn12 |
| InChI | InChI=1S/C9H9NO/c11-7-9-5-4-8-3-1-2-6-10(8)9/h1-6,11H,7H2 |
| InChIKey | ICNYNYILSFQOLY-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 24.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.18 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze indolizin-3-ylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of indolizin-3-ylmethanol?
The IUPAC name of indolizin-3-ylmethanol (CID 119088496) is indolizin-3-ylmethanol.
What is the SMILES notation for indolizin-3-ylmethanol?
The canonical SMILES for indolizin-3-ylmethanol is OCc1ccc2ccccn12.
What is the InChIKey of indolizin-3-ylmethanol?
The InChIKey is ICNYNYILSFQOLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NO/c11-7-9-5-4-8-3-1-2-6-10(8)9/h1-6,11H,7H2.
What are the key properties of indolizin-3-ylmethanol?
indolizin-3-ylmethanol has a molecular weight of 147.18 g/mol, XLogP of 1.43, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for indolizin-3-ylmethanol is sourced from PubChem (CID 119088496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).