About (2E)-2-(6,7-dihydro-5H-1-benzothiophen-4-ylidene)ethanol
(2E)-2-(6,7-dihydro-5H-1-benzothiophen-4-ylidene)ethanol (PubChem CID 119089142) has the molecular formula C10H12OS
and a molecular weight of 180.27 g/mol. Its IUPAC name is (2E)-2-(6,7-dihydro-5H-1-benzothiophen-4-ylidene)ethanol.
Molecular Properties
| Compound Name | (2E)-2-(6,7-dihydro-5H-1-benzothiophen-4-ylidene)ethanol |
| PubChem CID | 119089142 |
| Molecular Formula | C10H12OS |
| Molecular Weight | 180.27 g/mol |
| Exact Mass | 180.06 |
| IUPAC Name | (2E)-2-(6,7-dihydro-5H-1-benzothiophen-4-ylidene)ethanol |
| SMILES | OC/C=C1\CCCc2sccc21 |
| InChI | InChI=1S/C10H12OS/c11-6-4-8-2-1-3-10-9(8)5-7-12-10/h4-5,7,11H,1-3,6H2/b8-4+ |
| InChIKey | OQWABBTZBQIMQJ-XBXARRHUSA-N |
| XLogP | 2.46 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.27 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2E)-2-(6,7-dihydro-5H-1-benzothiophen-4-ylidene)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E)-2-(6,7-dihydro-5H-1-benzothiophen-4-ylidene)ethanol?
The IUPAC name of (2E)-2-(6,7-dihydro-5H-1-benzothiophen-4-ylidene)ethanol (CID 119089142) is (2E)-2-(6,7-dihydro-5H-1-benzothiophen-4-ylidene)ethanol.
What is the SMILES notation for (2E)-2-(6,7-dihydro-5H-1-benzothiophen-4-ylidene)ethanol?
The canonical SMILES for (2E)-2-(6,7-dihydro-5H-1-benzothiophen-4-ylidene)ethanol is OC/C=C1\CCCc2sccc21.
What is the InChIKey of (2E)-2-(6,7-dihydro-5H-1-benzothiophen-4-ylidene)ethanol?
The InChIKey is OQWABBTZBQIMQJ-XBXARRHUSA-N. The full InChI is InChI=1S/C10H12OS/c11-6-4-8-2-1-3-10-9(8)5-7-12-10/h4-5,7,11H,1-3,6H2/b8-4+.
What are the key properties of (2E)-2-(6,7-dihydro-5H-1-benzothiophen-4-ylidene)ethanol?
(2E)-2-(6,7-dihydro-5H-1-benzothiophen-4-ylidene)ethanol has a molecular weight of 180.27 g/mol, XLogP of 2.46, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2E)-2-(6,7-dihydro-5H-1-benzothiophen-4-ylidene)ethanol is sourced from PubChem (CID 119089142), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).