C12H11FN2 — CID 119089651
N-(3-fluorophenyl)-6-methylpyridin-2-amine (PubChem CID 119089651) has the molecular formula C12H11FN2 and a molecular weight of 202.23 g/mol. Its IUPAC name is N-(3-fluorophenyl)-6-methylpyridin-2-amine.
| Compound Name | N-(3-fluorophenyl)-6-methylpyridin-2-amine |
|---|---|
| PubChem CID | 119089651 |
| Molecular Formula | C12H11FN2 |
| Molecular Weight | 202.23 g/mol |
| Exact Mass | 202.09 |
| IUPAC Name | N-(3-fluorophenyl)-6-methylpyridin-2-amine |
| SMILES | Cc1cccc(Nc2cccc(F)c2)n1 |
| InChI | InChI=1S/C12H11FN2/c1-9-4-2-7-12(14-9)15-11-6-3-5-10(13)8-11/h2-8H,1H3,(H,14,15) |
| InChIKey | UTTMCEWEAFFKFU-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.23 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |