About 1-(5-iodo-1,3-thiazol-2-yl)-1,3-dimethylurea
1-(5-iodo-1,3-thiazol-2-yl)-1,3-dimethylurea (PubChem CID 119090293) has the molecular formula C6H8IN3OS
and a molecular weight of 297.12 g/mol. Its IUPAC name is 1-(5-iodo-1,3-thiazol-2-yl)-1,3-dimethylurea.
Molecular Properties
| Compound Name | 1-(5-iodo-1,3-thiazol-2-yl)-1,3-dimethylurea |
| PubChem CID | 119090293 |
| Molecular Formula | C6H8IN3OS |
| Molecular Weight | 297.12 g/mol |
| Exact Mass | 296.94 |
| IUPAC Name | 1-(5-iodo-1,3-thiazol-2-yl)-1,3-dimethylurea |
| SMILES | CNC(=O)N(C)c1ncc(I)s1 |
| InChI | InChI=1S/C6H8IN3OS/c1-8-5(11)10(2)6-9-3-4(7)12-6/h3H,1-2H3,(H,8,11) |
| InChIKey | UUOIYHYJWAGZPL-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.12 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-(5-iodo-1,3-thiazol-2-yl)-1,3-dimethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-iodo-1,3-thiazol-2-yl)-1,3-dimethylurea?
The IUPAC name of 1-(5-iodo-1,3-thiazol-2-yl)-1,3-dimethylurea (CID 119090293) is 1-(5-iodo-1,3-thiazol-2-yl)-1,3-dimethylurea.
What is the SMILES notation for 1-(5-iodo-1,3-thiazol-2-yl)-1,3-dimethylurea?
The canonical SMILES for 1-(5-iodo-1,3-thiazol-2-yl)-1,3-dimethylurea is CNC(=O)N(C)c1ncc(I)s1.
What is the InChIKey of 1-(5-iodo-1,3-thiazol-2-yl)-1,3-dimethylurea?
The InChIKey is UUOIYHYJWAGZPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8IN3OS/c1-8-5(11)10(2)6-9-3-4(7)12-6/h3H,1-2H3,(H,8,11).
What are the key properties of 1-(5-iodo-1,3-thiazol-2-yl)-1,3-dimethylurea?
1-(5-iodo-1,3-thiazol-2-yl)-1,3-dimethylurea has a molecular weight of 297.12 g/mol, XLogP of 1.52, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-iodo-1,3-thiazol-2-yl)-1,3-dimethylurea is sourced from PubChem (CID 119090293), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).