About 2,4-diisocyanatoquinoline
2,4-diisocyanatoquinoline (PubChem CID 119090392) has the molecular formula C11H5N3O2
and a molecular weight of 211.18 g/mol. Its IUPAC name is 2,4-diisocyanatoquinoline.
Molecular Properties
| Compound Name | 2,4-diisocyanatoquinoline |
| PubChem CID | 119090392 |
| Molecular Formula | C11H5N3O2 |
| Molecular Weight | 211.18 g/mol |
| Exact Mass | 211.04 |
| IUPAC Name | 2,4-diisocyanatoquinoline |
| SMILES | O=C=Nc1cc(N=C=O)c2ccccc2n1 |
| InChI | InChI=1S/C11H5N3O2/c15-6-12-10-5-11(13-7-16)14-9-4-2-1-3-8(9)10/h1-5H |
| InChIKey | AQNJJVASWDEKNC-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 71.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.18 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 2,4-diisocyanatoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-diisocyanatoquinoline?
The IUPAC name of 2,4-diisocyanatoquinoline (CID 119090392) is 2,4-diisocyanatoquinoline.
What is the SMILES notation for 2,4-diisocyanatoquinoline?
The canonical SMILES for 2,4-diisocyanatoquinoline is O=C=Nc1cc(N=C=O)c2ccccc2n1.
What is the InChIKey of 2,4-diisocyanatoquinoline?
The InChIKey is AQNJJVASWDEKNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H5N3O2/c15-6-12-10-5-11(13-7-16)14-9-4-2-1-3-8(9)10/h1-5H.
What are the key properties of 2,4-diisocyanatoquinoline?
2,4-diisocyanatoquinoline has a molecular weight of 211.18 g/mol, XLogP of 2.17, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-diisocyanatoquinoline is sourced from PubChem (CID 119090392), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).