About quinoline-4-carbonyl cyanide
quinoline-4-carbonyl cyanide (PubChem CID 119091066) has the molecular formula C11H6N2O
and a molecular weight of 182.18 g/mol. Its IUPAC name is quinoline-4-carbonyl cyanide.
Molecular Properties
| Compound Name | quinoline-4-carbonyl cyanide |
| PubChem CID | 119091066 |
| Molecular Formula | C11H6N2O |
| Molecular Weight | 182.18 g/mol |
| Exact Mass | 182.05 |
| IUPAC Name | quinoline-4-carbonyl cyanide |
| SMILES | N#CC(=O)c1ccnc2ccccc12 |
| InChI | InChI=1S/C11H6N2O/c12-7-11(14)9-5-6-13-10-4-2-1-3-8(9)10/h1-6H |
| InChIKey | DQQJVLXAGSLLAC-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 53.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.18 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_cyanide', 'substructure': 'N/A'} |
|---|
Analyze quinoline-4-carbonyl cyanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of quinoline-4-carbonyl cyanide?
The IUPAC name of quinoline-4-carbonyl cyanide (CID 119091066) is quinoline-4-carbonyl cyanide.
What is the SMILES notation for quinoline-4-carbonyl cyanide?
The canonical SMILES for quinoline-4-carbonyl cyanide is N#CC(=O)c1ccnc2ccccc12.
What is the InChIKey of quinoline-4-carbonyl cyanide?
The InChIKey is DQQJVLXAGSLLAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H6N2O/c12-7-11(14)9-5-6-13-10-4-2-1-3-8(9)10/h1-6H.
What are the key properties of quinoline-4-carbonyl cyanide?
quinoline-4-carbonyl cyanide has a molecular weight of 182.18 g/mol, XLogP of 1.94, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for quinoline-4-carbonyl cyanide is sourced from PubChem (CID 119091066), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).