About 2-acetamido-1,6-naphthyridine-3-carboxamide
2-acetamido-1,6-naphthyridine-3-carboxamide (PubChem CID 119091138) has the molecular formula C11H10N4O2
and a molecular weight of 230.23 g/mol. Its IUPAC name is 2-acetamido-1,6-naphthyridine-3-carboxamide.
Molecular Properties
| Compound Name | 2-acetamido-1,6-naphthyridine-3-carboxamide |
| PubChem CID | 119091138 |
| Molecular Formula | C11H10N4O2 |
| Molecular Weight | 230.23 g/mol |
| Exact Mass | 230.08 |
| IUPAC Name | 2-acetamido-1,6-naphthyridine-3-carboxamide |
| SMILES | CC(=O)Nc1nc2ccncc2cc1C(N)=O |
| InChI | InChI=1S/C11H10N4O2/c1-6(16)14-11-8(10(12)17)4-7-5-13-3-2-9(7)15-11/h2-5H,1H3,(H2,12,17)(H,14,15,16) |
| InChIKey | ICCHFJUOYVSRGR-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.23 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-acetamido-1,6-naphthyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-acetamido-1,6-naphthyridine-3-carboxamide?
The IUPAC name of 2-acetamido-1,6-naphthyridine-3-carboxamide (CID 119091138) is 2-acetamido-1,6-naphthyridine-3-carboxamide.
What is the SMILES notation for 2-acetamido-1,6-naphthyridine-3-carboxamide?
The canonical SMILES for 2-acetamido-1,6-naphthyridine-3-carboxamide is CC(=O)Nc1nc2ccncc2cc1C(N)=O.
What is the InChIKey of 2-acetamido-1,6-naphthyridine-3-carboxamide?
The InChIKey is ICCHFJUOYVSRGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N4O2/c1-6(16)14-11-8(10(12)17)4-7-5-13-3-2-9(7)15-11/h2-5H,1H3,(H2,12,17)(H,14,15,16).
What are the key properties of 2-acetamido-1,6-naphthyridine-3-carboxamide?
2-acetamido-1,6-naphthyridine-3-carboxamide has a molecular weight of 230.23 g/mol, XLogP of 0.69, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-acetamido-1,6-naphthyridine-3-carboxamide is sourced from PubChem (CID 119091138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).