About 6-butylpteridine-2,4-diamine
6-butylpteridine-2,4-diamine (PubChem CID 119091307) has the molecular formula C10H14N6
and a molecular weight of 218.26 g/mol. Its IUPAC name is 6-butylpteridine-2,4-diamine.
Molecular Properties
| Compound Name | 6-butylpteridine-2,4-diamine |
| PubChem CID | 119091307 |
| Molecular Formula | C10H14N6 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | 6-butylpteridine-2,4-diamine |
| SMILES | CCCCc1cnc2nc(N)nc(N)c2n1 |
| InChI | InChI=1S/C10H14N6/c1-2-3-4-6-5-13-9-7(14-6)8(11)15-10(12)16-9/h5H,2-4H2,1H3,(H4,11,12,13,15,16) |
| InChIKey | DIESQRSZCPOAFE-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 103.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-butylpteridine-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-butylpteridine-2,4-diamine?
The IUPAC name of 6-butylpteridine-2,4-diamine (CID 119091307) is 6-butylpteridine-2,4-diamine.
What is the SMILES notation for 6-butylpteridine-2,4-diamine?
The canonical SMILES for 6-butylpteridine-2,4-diamine is CCCCc1cnc2nc(N)nc(N)c2n1.
What is the InChIKey of 6-butylpteridine-2,4-diamine?
The InChIKey is DIESQRSZCPOAFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N6/c1-2-3-4-6-5-13-9-7(14-6)8(11)15-10(12)16-9/h5H,2-4H2,1H3,(H4,11,12,13,15,16).
What are the key properties of 6-butylpteridine-2,4-diamine?
6-butylpteridine-2,4-diamine has a molecular weight of 218.26 g/mol, XLogP of 0.93, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-butylpteridine-2,4-diamine is sourced from PubChem (CID 119091307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).