About (5-methyl-1,3-oxazol-2-yl)cyanamide
(5-methyl-1,3-oxazol-2-yl)cyanamide (PubChem CID 119091426) has the molecular formula C5H5N3O
and a molecular weight of 123.11 g/mol. Its IUPAC name is (5-methyl-1,3-oxazol-2-yl)cyanamide.
Molecular Properties
| Compound Name | (5-methyl-1,3-oxazol-2-yl)cyanamide |
| PubChem CID | 119091426 |
| Molecular Formula | C5H5N3O |
| Molecular Weight | 123.11 g/mol |
| Exact Mass | 123.04 |
| IUPAC Name | (5-methyl-1,3-oxazol-2-yl)cyanamide |
| SMILES | Cc1cnc(NC#N)o1 |
| InChI | InChI=1S/C5H5N3O/c1-4-2-7-5(9-4)8-3-6/h2H,1H3,(H,7,8) |
| InChIKey | JFRQLDXODRIMMF-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 123.11 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|
Analyze (5-methyl-1,3-oxazol-2-yl)cyanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-methyl-1,3-oxazol-2-yl)cyanamide?
The IUPAC name of (5-methyl-1,3-oxazol-2-yl)cyanamide (CID 119091426) is (5-methyl-1,3-oxazol-2-yl)cyanamide.
What is the SMILES notation for (5-methyl-1,3-oxazol-2-yl)cyanamide?
The canonical SMILES for (5-methyl-1,3-oxazol-2-yl)cyanamide is Cc1cnc(NC#N)o1.
What is the InChIKey of (5-methyl-1,3-oxazol-2-yl)cyanamide?
The InChIKey is JFRQLDXODRIMMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5N3O/c1-4-2-7-5(9-4)8-3-6/h2H,1H3,(H,7,8).
What are the key properties of (5-methyl-1,3-oxazol-2-yl)cyanamide?
(5-methyl-1,3-oxazol-2-yl)cyanamide has a molecular weight of 123.11 g/mol, XLogP of 0.88, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5-methyl-1,3-oxazol-2-yl)cyanamide is sourced from PubChem (CID 119091426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).