About 1-methyl-3-(5-methyl-1,3-thiazol-2-yl)thiourea
1-methyl-3-(5-methyl-1,3-thiazol-2-yl)thiourea (PubChem CID 119091478) has the molecular formula C6H9N3S2
and a molecular weight of 187.29 g/mol. Its IUPAC name is 1-methyl-3-(5-methyl-1,3-thiazol-2-yl)thiourea.
Molecular Properties
| Compound Name | 1-methyl-3-(5-methyl-1,3-thiazol-2-yl)thiourea |
| PubChem CID | 119091478 |
| Molecular Formula | C6H9N3S2 |
| Molecular Weight | 187.29 g/mol |
| Exact Mass | 187.02 |
| IUPAC Name | 1-methyl-3-(5-methyl-1,3-thiazol-2-yl)thiourea |
| SMILES | CNC(=S)Nc1ncc(C)s1 |
| InChI | InChI=1S/C6H9N3S2/c1-4-3-8-6(11-4)9-5(10)7-2/h3H,1-2H3,(H2,7,8,9,10) |
| InChIKey | UBYYVTBWIBMBQO-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.29 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-3-(5-methyl-1,3-thiazol-2-yl)thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-3-(5-methyl-1,3-thiazol-2-yl)thiourea?
The IUPAC name of 1-methyl-3-(5-methyl-1,3-thiazol-2-yl)thiourea (CID 119091478) is 1-methyl-3-(5-methyl-1,3-thiazol-2-yl)thiourea.
What is the SMILES notation for 1-methyl-3-(5-methyl-1,3-thiazol-2-yl)thiourea?
The canonical SMILES for 1-methyl-3-(5-methyl-1,3-thiazol-2-yl)thiourea is CNC(=S)Nc1ncc(C)s1.
What is the InChIKey of 1-methyl-3-(5-methyl-1,3-thiazol-2-yl)thiourea?
The InChIKey is UBYYVTBWIBMBQO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N3S2/c1-4-3-8-6(11-4)9-5(10)7-2/h3H,1-2H3,(H2,7,8,9,10).
What are the key properties of 1-methyl-3-(5-methyl-1,3-thiazol-2-yl)thiourea?
1-methyl-3-(5-methyl-1,3-thiazol-2-yl)thiourea has a molecular weight of 187.29 g/mol, XLogP of 1.37, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-3-(5-methyl-1,3-thiazol-2-yl)thiourea is sourced from PubChem (CID 119091478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).