About 2-chloro-4-ethylsulfanyl-6-isocyanato-1,3,5-triazine
2-chloro-4-ethylsulfanyl-6-isocyanato-1,3,5-triazine (PubChem CID 119091839) has the molecular formula C6H5ClN4OS
and a molecular weight of 216.65 g/mol. Its IUPAC name is 2-chloro-4-ethylsulfanyl-6-isocyanato-1,3,5-triazine.
Molecular Properties
| Compound Name | 2-chloro-4-ethylsulfanyl-6-isocyanato-1,3,5-triazine |
| PubChem CID | 119091839 |
| Molecular Formula | C6H5ClN4OS |
| Molecular Weight | 216.65 g/mol |
| Exact Mass | 215.99 |
| IUPAC Name | 2-chloro-4-ethylsulfanyl-6-isocyanato-1,3,5-triazine |
| SMILES | CCSc1nc(Cl)nc(N=C=O)n1 |
| InChI | InChI=1S/C6H5ClN4OS/c1-2-13-6-10-4(7)9-5(11-6)8-3-12/h2H2,1H3 |
| InChIKey | IKUCHWUXRPFWED-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 68.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.65 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-4-ethylsulfanyl-6-isocyanato-1,3,5-triazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-4-ethylsulfanyl-6-isocyanato-1,3,5-triazine?
The IUPAC name of 2-chloro-4-ethylsulfanyl-6-isocyanato-1,3,5-triazine (CID 119091839) is 2-chloro-4-ethylsulfanyl-6-isocyanato-1,3,5-triazine.
What is the SMILES notation for 2-chloro-4-ethylsulfanyl-6-isocyanato-1,3,5-triazine?
The canonical SMILES for 2-chloro-4-ethylsulfanyl-6-isocyanato-1,3,5-triazine is CCSc1nc(Cl)nc(N=C=O)n1.
What is the InChIKey of 2-chloro-4-ethylsulfanyl-6-isocyanato-1,3,5-triazine?
The InChIKey is IKUCHWUXRPFWED-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5ClN4OS/c1-2-13-6-10-4(7)9-5(11-6)8-3-12/h2H2,1H3.
What are the key properties of 2-chloro-4-ethylsulfanyl-6-isocyanato-1,3,5-triazine?
2-chloro-4-ethylsulfanyl-6-isocyanato-1,3,5-triazine has a molecular weight of 216.65 g/mol, XLogP of 1.60, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-4-ethylsulfanyl-6-isocyanato-1,3,5-triazine is sourced from PubChem (CID 119091839), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).