About 2-(dimethylaminodiazenyl)benzene-1,3,5-tricarboxamide
2-(dimethylaminodiazenyl)benzene-1,3,5-tricarboxamide (PubChem CID 119092147) has the molecular formula C11H14N6O3
and a molecular weight of 278.27 g/mol. Its IUPAC name is 2-(dimethylaminodiazenyl)benzene-1,3,5-tricarboxamide.
Molecular Properties
| Compound Name | 2-(dimethylaminodiazenyl)benzene-1,3,5-tricarboxamide |
| PubChem CID | 119092147 |
| Molecular Formula | C11H14N6O3 |
| Molecular Weight | 278.27 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | 2-(dimethylaminodiazenyl)benzene-1,3,5-tricarboxamide |
| SMILES | CN(C)/N=N/c1c(C(N)=O)cc(C(N)=O)cc1C(N)=O |
| InChI | InChI=1S/C11H14N6O3/c1-17(2)16-15-8-6(10(13)19)3-5(9(12)18)4-7(8)11(14)20/h3-4H,1-2H3,(H2,12,18)(H2,13,19)(H2,14,20)/b16-15+ |
| InChIKey | FQEZVXHDEDRMOD-FOCLMDBBSA-N |
| XLogP | -0.46 |
| TPSA | 157.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.27 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(dimethylaminodiazenyl)benzene-1,3,5-tricarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dimethylaminodiazenyl)benzene-1,3,5-tricarboxamide?
The IUPAC name of 2-(dimethylaminodiazenyl)benzene-1,3,5-tricarboxamide (CID 119092147) is 2-(dimethylaminodiazenyl)benzene-1,3,5-tricarboxamide.
What is the SMILES notation for 2-(dimethylaminodiazenyl)benzene-1,3,5-tricarboxamide?
The canonical SMILES for 2-(dimethylaminodiazenyl)benzene-1,3,5-tricarboxamide is CN(C)/N=N/c1c(C(N)=O)cc(C(N)=O)cc1C(N)=O.
What is the InChIKey of 2-(dimethylaminodiazenyl)benzene-1,3,5-tricarboxamide?
The InChIKey is FQEZVXHDEDRMOD-FOCLMDBBSA-N. The full InChI is InChI=1S/C11H14N6O3/c1-17(2)16-15-8-6(10(13)19)3-5(9(12)18)4-7(8)11(14)20/h3-4H,1-2H3,(H2,12,18)(H2,13,19)(H2,14,20)/b16-15+.
What are the key properties of 2-(dimethylaminodiazenyl)benzene-1,3,5-tricarboxamide?
2-(dimethylaminodiazenyl)benzene-1,3,5-tricarboxamide has a molecular weight of 278.27 g/mol, XLogP of -0.46, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dimethylaminodiazenyl)benzene-1,3,5-tricarboxamide is sourced from PubChem (CID 119092147), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).