C9H5ClN2O2 — CID 119092458
4-oxo-3H-phthalazine-5-carbonyl chloride (PubChem CID 119092458) has the molecular formula C9H5ClN2O2 and a molecular weight of 208.60 g/mol. Its IUPAC name is 4-oxo-3H-phthalazine-5-carbonyl chloride.
| Compound Name | 4-oxo-3H-phthalazine-5-carbonyl chloride |
|---|---|
| PubChem CID | 119092458 |
| Molecular Formula | C9H5ClN2O2 |
| Molecular Weight | 208.60 g/mol |
| Exact Mass | 208.00 |
| IUPAC Name | 4-oxo-3H-phthalazine-5-carbonyl chloride |
| SMILES | O=C(Cl)c1cccc2cn[nH]c(=O)c12 |
| InChI | InChI=1S/C9H5ClN2O2/c10-8(13)6-3-1-2-5-4-11-12-9(14)7(5)6/h1-4H,(H,12,14) |
| InChIKey | CENHHVVBXPYYOW-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 62.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.60 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|