C6H10Br4O2S — CID 119092697
1,2-dibromo-3-(2,3-dibromopropylsulfonyl)propane (PubChem CID 119092697) has the molecular formula C6H10Br4O2S and a molecular weight of 465.83 g/mol. Its IUPAC name is 1,2-dibromo-3-(2,3-dibromopropylsulfonyl)propane.
| Compound Name | 1,2-dibromo-3-(2,3-dibromopropylsulfonyl)propane |
|---|---|
| PubChem CID | 119092697 |
| Molecular Formula | C6H10Br4O2S |
| Molecular Weight | 465.83 g/mol |
| Exact Mass | 461.71 |
| IUPAC Name | 1,2-dibromo-3-(2,3-dibromopropylsulfonyl)propane |
| SMILES | O=S(=O)(CC(Br)CBr)CC(Br)CBr |
| InChI | InChI=1S/C6H10Br4O2S/c7-1-5(9)3-13(11,12)4-6(10)2-8/h5-6H,1-4H2 |
| InChIKey | AJVRMHVZGCHBPN-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.83 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|