About 4-(bromomethyl)-1,2,3,4-tetrahydroquinoline
4-(bromomethyl)-1,2,3,4-tetrahydroquinoline (PubChem CID 119093179) has the molecular formula C10H12BrN
and a molecular weight of 226.12 g/mol. Its IUPAC name is 4-(bromomethyl)-1,2,3,4-tetrahydroquinoline.
Molecular Properties
| Compound Name | 4-(bromomethyl)-1,2,3,4-tetrahydroquinoline |
| PubChem CID | 119093179 |
| Molecular Formula | C10H12BrN |
| Molecular Weight | 226.12 g/mol |
| Exact Mass | 225.02 |
| IUPAC Name | 4-(bromomethyl)-1,2,3,4-tetrahydroquinoline |
| SMILES | BrCC1CCNc2ccccc21 |
| InChI | InChI=1S/C10H12BrN/c11-7-8-5-6-12-10-4-2-1-3-9(8)10/h1-4,8,12H,5-7H2 |
| InChIKey | QDOYMVKUAOEIMX-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.12 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-(bromomethyl)-1,2,3,4-tetrahydroquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(bromomethyl)-1,2,3,4-tetrahydroquinoline?
The IUPAC name of 4-(bromomethyl)-1,2,3,4-tetrahydroquinoline (CID 119093179) is 4-(bromomethyl)-1,2,3,4-tetrahydroquinoline.
What is the SMILES notation for 4-(bromomethyl)-1,2,3,4-tetrahydroquinoline?
The canonical SMILES for 4-(bromomethyl)-1,2,3,4-tetrahydroquinoline is BrCC1CCNc2ccccc21.
What is the InChIKey of 4-(bromomethyl)-1,2,3,4-tetrahydroquinoline?
The InChIKey is QDOYMVKUAOEIMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12BrN/c11-7-8-5-6-12-10-4-2-1-3-9(8)10/h1-4,8,12H,5-7H2.
What are the key properties of 4-(bromomethyl)-1,2,3,4-tetrahydroquinoline?
4-(bromomethyl)-1,2,3,4-tetrahydroquinoline has a molecular weight of 226.12 g/mol, XLogP of 2.98, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(bromomethyl)-1,2,3,4-tetrahydroquinoline is sourced from PubChem (CID 119093179), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).