About 2,4-dimethyl-6-[(E)-3,3,3-trichloroprop-1-enyl]pyridine
2,4-dimethyl-6-[(E)-3,3,3-trichloroprop-1-enyl]pyridine (PubChem CID 119093338) has the molecular formula C10H10Cl3N
and a molecular weight of 250.56 g/mol. Its IUPAC name is 2,4-dimethyl-6-[(E)-3,3,3-trichloroprop-1-enyl]pyridine.
Molecular Properties
| Compound Name | 2,4-dimethyl-6-[(E)-3,3,3-trichloroprop-1-enyl]pyridine |
| PubChem CID | 119093338 |
| Molecular Formula | C10H10Cl3N |
| Molecular Weight | 250.56 g/mol |
| Exact Mass | 248.99 |
| IUPAC Name | 2,4-dimethyl-6-[(E)-3,3,3-trichloroprop-1-enyl]pyridine |
| SMILES | Cc1cc(C)nc(/C=C/C(Cl)(Cl)Cl)c1 |
| InChI | InChI=1S/C10H10Cl3N/c1-7-5-8(2)14-9(6-7)3-4-10(11,12)13/h3-6H,1-2H3/b4-3+ |
| InChIKey | WPEMVNDSNHCLRF-ONEGZZNKSA-N |
| XLogP | 4.08 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.56 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2,4-dimethyl-6-[(E)-3,3,3-trichloroprop-1-enyl]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dimethyl-6-[(E)-3,3,3-trichloroprop-1-enyl]pyridine?
The IUPAC name of 2,4-dimethyl-6-[(E)-3,3,3-trichloroprop-1-enyl]pyridine (CID 119093338) is 2,4-dimethyl-6-[(E)-3,3,3-trichloroprop-1-enyl]pyridine.
What is the SMILES notation for 2,4-dimethyl-6-[(E)-3,3,3-trichloroprop-1-enyl]pyridine?
The canonical SMILES for 2,4-dimethyl-6-[(E)-3,3,3-trichloroprop-1-enyl]pyridine is Cc1cc(C)nc(/C=C/C(Cl)(Cl)Cl)c1.
What is the InChIKey of 2,4-dimethyl-6-[(E)-3,3,3-trichloroprop-1-enyl]pyridine?
The InChIKey is WPEMVNDSNHCLRF-ONEGZZNKSA-N. The full InChI is InChI=1S/C10H10Cl3N/c1-7-5-8(2)14-9(6-7)3-4-10(11,12)13/h3-6H,1-2H3/b4-3+.
What are the key properties of 2,4-dimethyl-6-[(E)-3,3,3-trichloroprop-1-enyl]pyridine?
2,4-dimethyl-6-[(E)-3,3,3-trichloroprop-1-enyl]pyridine has a molecular weight of 250.56 g/mol, XLogP of 4.08, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dimethyl-6-[(E)-3,3,3-trichloroprop-1-enyl]pyridine is sourced from PubChem (CID 119093338), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).