About 5-aminosulfanyl-1,3-thiazole-2-carboxamide
5-aminosulfanyl-1,3-thiazole-2-carboxamide (PubChem CID 119093368) has the molecular formula C4H5N3OS2
and a molecular weight of 175.24 g/mol. Its IUPAC name is 5-aminosulfanyl-1,3-thiazole-2-carboxamide.
Molecular Properties
| Compound Name | 5-aminosulfanyl-1,3-thiazole-2-carboxamide |
| PubChem CID | 119093368 |
| Molecular Formula | C4H5N3OS2 |
| Molecular Weight | 175.24 g/mol |
| Exact Mass | 174.99 |
| IUPAC Name | 5-aminosulfanyl-1,3-thiazole-2-carboxamide |
| SMILES | NSc1cnc(C(N)=O)s1 |
| InChI | InChI=1S/C4H5N3OS2/c5-3(8)4-7-1-2(9-4)10-6/h1H,6H2,(H2,5,8) |
| InChIKey | YGITXTOLAMRRLL-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 82.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.24 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-aminosulfanyl-1,3-thiazole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-aminosulfanyl-1,3-thiazole-2-carboxamide?
The IUPAC name of 5-aminosulfanyl-1,3-thiazole-2-carboxamide (CID 119093368) is 5-aminosulfanyl-1,3-thiazole-2-carboxamide.
What is the SMILES notation for 5-aminosulfanyl-1,3-thiazole-2-carboxamide?
The canonical SMILES for 5-aminosulfanyl-1,3-thiazole-2-carboxamide is NSc1cnc(C(N)=O)s1.
What is the InChIKey of 5-aminosulfanyl-1,3-thiazole-2-carboxamide?
The InChIKey is YGITXTOLAMRRLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5N3OS2/c5-3(8)4-7-1-2(9-4)10-6/h1H,6H2,(H2,5,8).
What are the key properties of 5-aminosulfanyl-1,3-thiazole-2-carboxamide?
5-aminosulfanyl-1,3-thiazole-2-carboxamide has a molecular weight of 175.24 g/mol, XLogP of 0.21, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-aminosulfanyl-1,3-thiazole-2-carboxamide is sourced from PubChem (CID 119093368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).