C19H25N3OS3 — CID 11909337
N-[(1S,2S,3S)-2,3-dimethylcyclohexyl]-2-[[4-(2-methylphenyl)-5-sulfanylidene-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide (PubChem CID 11909337) has the molecular formula C19H25N3OS3 and a molecular weight of 407.63 g/mol. Its IUPAC name is N-[(1S,2S,3S)-2,3-dimethylcyclohexyl]-2-[[4-(2-methylphenyl)-5-sulfanylidene-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide.
| Compound Name | N-[(1S,2S,3S)-2,3-dimethylcyclohexyl]-2-[[4-(2-methylphenyl)-5-sulfanylidene-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 11909337 |
| Molecular Formula | C19H25N3OS3 |
| Molecular Weight | 407.63 g/mol |
| Exact Mass | 407.12 |
| IUPAC Name | N-[(1S,2S,3S)-2,3-dimethylcyclohexyl]-2-[[4-(2-methylphenyl)-5-sulfanylidene-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide |
| SMILES | Cc1ccccc1-n1nc(SCC(=O)N[C@H]2CCC[C@H](C)[C@@H]2C)sc1=S |
| InChI | InChI=1S/C19H25N3OS3/c1-12-8-6-9-15(14(12)3)20-17(23)11-25-18-21-22(19(24)26-18)16-10-5-4-7-13(16)2/h4-5,7,10,12,14-15H,6,8-9,11H2,1-3H3,(H,20,23)/t12-,14-,15-/m0/s1 |
| InChIKey | DXJVPNLNCODUBH-QEJZJMRPSA-N |
| XLogP | 5.00 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.63 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|