C23H37N3OS — CID 11909407
[(E)-1-[(3S,5S,8S,9R,10S,13S,14S)-3-hydroxy-10,13,16-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethylideneamino]thiourea (PubChem CID 11909407) has the molecular formula C23H37N3OS and a molecular weight of 403.64 g/mol. Its IUPAC name is [(E)-1-[(3S,5S,8S,9R,10S,13S,14S)-3-hydroxy-10,13,16-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethylideneamino]thiourea.
| Compound Name | [(E)-1-[(3S,5S,8S,9R,10S,13S,14S)-3-hydroxy-10,13,16-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethylideneamino]thiourea |
|---|---|
| PubChem CID | 11909407 |
| Molecular Formula | C23H37N3OS |
| Molecular Weight | 403.64 g/mol |
| Exact Mass | 403.27 |
| IUPAC Name | [(E)-1-[(3S,5S,8S,9R,10S,13S,14S)-3-hydroxy-10,13,16-trimethyl-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethylideneamino]thiourea |
| SMILES | CC1=C(/C(C)=N/NC(N)=S)[C@@]2(C)CC[C@@H]3[C@H](CC[C@H]4C[C@@H](O)CC[C@@]43C)[C@@H]2C1 |
| InChI | InChI=1S/C23H37N3OS/c1-13-11-19-17-6-5-15-12-16(27)7-9-22(15,3)18(17)8-10-23(19,4)20(13)14(2)25-26-21(24)28/h15-19,27H,5-12H2,1-4H3,(H3,24,26,28)/b25-14+/t15-,16-,17-,18+,19-,22-,23-/m0/s1 |
| InChIKey | PBKBWZCHBYZBOK-DRGMNMPQSA-N |
| XLogP | 4.53 |
| TPSA | 70.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.64 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|