About 2-fluoro-N,N-dimethyl-2,2-dinitroethanamine
2-fluoro-N,N-dimethyl-2,2-dinitroethanamine (PubChem CID 119095712) has the molecular formula C4H8FN3O4
and a molecular weight of 181.12 g/mol. Its IUPAC name is 2-fluoro-N,N-dimethyl-2,2-dinitroethanamine.
Molecular Properties
| Compound Name | 2-fluoro-N,N-dimethyl-2,2-dinitroethanamine |
| PubChem CID | 119095712 |
| Molecular Formula | C4H8FN3O4 |
| Molecular Weight | 181.12 g/mol |
| Exact Mass | 181.05 |
| IUPAC Name | 2-fluoro-N,N-dimethyl-2,2-dinitroethanamine |
| SMILES | CN(C)CC(F)([N+](=O)[O-])[N+](=O)[O-] |
| InChI | InChI=1S/C4H8FN3O4/c1-6(2)3-4(5,7(9)10)8(11)12/h3H2,1-2H3 |
| InChIKey | MHCFLIKUEONSGZ-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.12 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoro-N,N-dimethyl-2,2-dinitroethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-N,N-dimethyl-2,2-dinitroethanamine?
The IUPAC name of 2-fluoro-N,N-dimethyl-2,2-dinitroethanamine (CID 119095712) is 2-fluoro-N,N-dimethyl-2,2-dinitroethanamine.
What is the SMILES notation for 2-fluoro-N,N-dimethyl-2,2-dinitroethanamine?
The canonical SMILES for 2-fluoro-N,N-dimethyl-2,2-dinitroethanamine is CN(C)CC(F)([N+](=O)[O-])[N+](=O)[O-].
What is the InChIKey of 2-fluoro-N,N-dimethyl-2,2-dinitroethanamine?
The InChIKey is MHCFLIKUEONSGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8FN3O4/c1-6(2)3-4(5,7(9)10)8(11)12/h3H2,1-2H3.
What are the key properties of 2-fluoro-N,N-dimethyl-2,2-dinitroethanamine?
2-fluoro-N,N-dimethyl-2,2-dinitroethanamine has a molecular weight of 181.12 g/mol, XLogP of -0.28, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-N,N-dimethyl-2,2-dinitroethanamine is sourced from PubChem (CID 119095712), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).