About 3-ethylsulfinyl-1,2,4-thiadiazol-5-amine
3-ethylsulfinyl-1,2,4-thiadiazol-5-amine (PubChem CID 119095848) has the molecular formula C4H7N3OS2
and a molecular weight of 177.25 g/mol. Its IUPAC name is 3-ethylsulfinyl-1,2,4-thiadiazol-5-amine.
Molecular Properties
| Compound Name | 3-ethylsulfinyl-1,2,4-thiadiazol-5-amine |
| PubChem CID | 119095848 |
| Molecular Formula | C4H7N3OS2 |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.00 |
| IUPAC Name | 3-ethylsulfinyl-1,2,4-thiadiazol-5-amine |
| SMILES | CCS(=O)c1nsc(N)n1 |
| InChI | InChI=1S/C4H7N3OS2/c1-2-10(8)4-6-3(5)9-7-4/h2H2,1H3,(H2,5,6,7) |
| InChIKey | WSBXHTWTXCPRIO-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-ethylsulfinyl-1,2,4-thiadiazol-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethylsulfinyl-1,2,4-thiadiazol-5-amine?
The IUPAC name of 3-ethylsulfinyl-1,2,4-thiadiazol-5-amine (CID 119095848) is 3-ethylsulfinyl-1,2,4-thiadiazol-5-amine.
What is the SMILES notation for 3-ethylsulfinyl-1,2,4-thiadiazol-5-amine?
The canonical SMILES for 3-ethylsulfinyl-1,2,4-thiadiazol-5-amine is CCS(=O)c1nsc(N)n1.
What is the InChIKey of 3-ethylsulfinyl-1,2,4-thiadiazol-5-amine?
The InChIKey is WSBXHTWTXCPRIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7N3OS2/c1-2-10(8)4-6-3(5)9-7-4/h2H2,1H3,(H2,5,6,7).
What are the key properties of 3-ethylsulfinyl-1,2,4-thiadiazol-5-amine?
3-ethylsulfinyl-1,2,4-thiadiazol-5-amine has a molecular weight of 177.25 g/mol, XLogP of 0.25, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethylsulfinyl-1,2,4-thiadiazol-5-amine is sourced from PubChem (CID 119095848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).