About 5-methylsulfonyl-3-(trifluoromethyl)-1,2,4-thiadiazole
5-methylsulfonyl-3-(trifluoromethyl)-1,2,4-thiadiazole (PubChem CID 119095948) has the molecular formula C4H3F3N2O2S2
and a molecular weight of 232.21 g/mol. Its IUPAC name is 5-methylsulfonyl-3-(trifluoromethyl)-1,2,4-thiadiazole.
Molecular Properties
| Compound Name | 5-methylsulfonyl-3-(trifluoromethyl)-1,2,4-thiadiazole |
| PubChem CID | 119095948 |
| Molecular Formula | C4H3F3N2O2S2 |
| Molecular Weight | 232.21 g/mol |
| Exact Mass | 231.96 |
| IUPAC Name | 5-methylsulfonyl-3-(trifluoromethyl)-1,2,4-thiadiazole |
| SMILES | CS(=O)(=O)c1nc(C(F)(F)F)ns1 |
| InChI | InChI=1S/C4H3F3N2O2S2/c1-13(10,11)3-8-2(9-12-3)4(5,6)7/h1H3 |
| InChIKey | TUQTZYWMKOQMBJ-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.21 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-methylsulfonyl-3-(trifluoromethyl)-1,2,4-thiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methylsulfonyl-3-(trifluoromethyl)-1,2,4-thiadiazole?
The IUPAC name of 5-methylsulfonyl-3-(trifluoromethyl)-1,2,4-thiadiazole (CID 119095948) is 5-methylsulfonyl-3-(trifluoromethyl)-1,2,4-thiadiazole.
What is the SMILES notation for 5-methylsulfonyl-3-(trifluoromethyl)-1,2,4-thiadiazole?
The canonical SMILES for 5-methylsulfonyl-3-(trifluoromethyl)-1,2,4-thiadiazole is CS(=O)(=O)c1nc(C(F)(F)F)ns1.
What is the InChIKey of 5-methylsulfonyl-3-(trifluoromethyl)-1,2,4-thiadiazole?
The InChIKey is TUQTZYWMKOQMBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H3F3N2O2S2/c1-13(10,11)3-8-2(9-12-3)4(5,6)7/h1H3.
What are the key properties of 5-methylsulfonyl-3-(trifluoromethyl)-1,2,4-thiadiazole?
5-methylsulfonyl-3-(trifluoromethyl)-1,2,4-thiadiazole has a molecular weight of 232.21 g/mol, XLogP of 0.96, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methylsulfonyl-3-(trifluoromethyl)-1,2,4-thiadiazole is sourced from PubChem (CID 119095948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).