About 3-ethyl-6-methoxy-1,2,4,5-tetraoxane
3-ethyl-6-methoxy-1,2,4,5-tetraoxane (PubChem CID 119096406) has the molecular formula C5H10O5
and a molecular weight of 150.13 g/mol. Its IUPAC name is 3-ethyl-6-methoxy-1,2,4,5-tetraoxane.
Molecular Properties
| Compound Name | 3-ethyl-6-methoxy-1,2,4,5-tetraoxane |
| PubChem CID | 119096406 |
| Molecular Formula | C5H10O5 |
| Molecular Weight | 150.13 g/mol |
| Exact Mass | 150.05 |
| IUPAC Name | 3-ethyl-6-methoxy-1,2,4,5-tetraoxane |
| SMILES | CCC1OOC(OC)OO1 |
| InChI | InChI=1S/C5H10O5/c1-3-4-7-9-5(6-2)10-8-4/h4-5H,3H2,1-2H3 |
| InChIKey | HKWUBWNLNDUSDB-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.13 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 3-ethyl-6-methoxy-1,2,4,5-tetraoxane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-6-methoxy-1,2,4,5-tetraoxane?
The IUPAC name of 3-ethyl-6-methoxy-1,2,4,5-tetraoxane (CID 119096406) is 3-ethyl-6-methoxy-1,2,4,5-tetraoxane.
What is the SMILES notation for 3-ethyl-6-methoxy-1,2,4,5-tetraoxane?
The canonical SMILES for 3-ethyl-6-methoxy-1,2,4,5-tetraoxane is CCC1OOC(OC)OO1.
What is the InChIKey of 3-ethyl-6-methoxy-1,2,4,5-tetraoxane?
The InChIKey is HKWUBWNLNDUSDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10O5/c1-3-4-7-9-5(6-2)10-8-4/h4-5H,3H2,1-2H3.
What are the key properties of 3-ethyl-6-methoxy-1,2,4,5-tetraoxane?
3-ethyl-6-methoxy-1,2,4,5-tetraoxane has a molecular weight of 150.13 g/mol, XLogP of 0.56, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-6-methoxy-1,2,4,5-tetraoxane is sourced from PubChem (CID 119096406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).