C23H21FN2O4 — CID 11909725
(3aR,4S,8aS,8bS)-4-(4-fluorobenzoyl)-2-(4-methoxyphenyl)-4,6,7,8,8a,8b-hexahydro-3aH-pyrrolo[3,4-a]pyrrolizine-1,3-dione (PubChem CID 11909725) has the molecular formula C23H21FN2O4 and a molecular weight of 408.43 g/mol. Its IUPAC name is (3aR,4S,8aS,8bS)-4-(4-fluorobenzoyl)-2-(4-methoxyphenyl)-4,6,7,8,8a,8b-hexahydro-3aH-pyrrolo[3,4-a]pyrrolizine-1,3-dione.
| Compound Name | (3aR,4S,8aS,8bS)-4-(4-fluorobenzoyl)-2-(4-methoxyphenyl)-4,6,7,8,8a,8b-hexahydro-3aH-pyrrolo[3,4-a]pyrrolizine-1,3-dione |
|---|---|
| PubChem CID | 11909725 |
| Molecular Formula | C23H21FN2O4 |
| Molecular Weight | 408.43 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | (3aR,4S,8aS,8bS)-4-(4-fluorobenzoyl)-2-(4-methoxyphenyl)-4,6,7,8,8a,8b-hexahydro-3aH-pyrrolo[3,4-a]pyrrolizine-1,3-dione |
| SMILES | COc1ccc(N2C(=O)[C@@H]3[C@H](C2=O)[C@@H]2CCCN2[C@@H]3C(=O)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C23H21FN2O4/c1-30-16-10-8-15(9-11-16)26-22(28)18-17-3-2-12-25(17)20(19(18)23(26)29)21(27)13-4-6-14(24)7-5-13/h4-11,17-20H,2-3,12H2,1H3/t17-,18+,19+,20-/m0/s1 |
| InChIKey | YFJVTDOSLWIELC-NMLBUPMWSA-N |
| XLogP | 2.67 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.43 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|