About pteridine-6,7-diamine
pteridine-6,7-diamine (PubChem CID 119097307) has the molecular formula C6H6N6
and a molecular weight of 162.16 g/mol. Its IUPAC name is pteridine-6,7-diamine.
Molecular Properties
| Compound Name | pteridine-6,7-diamine |
| PubChem CID | 119097307 |
| Molecular Formula | C6H6N6 |
| Molecular Weight | 162.16 g/mol |
| Exact Mass | 162.07 |
| IUPAC Name | pteridine-6,7-diamine |
| SMILES | Nc1nc2cncnc2nc1N |
| InChI | InChI=1S/C6H6N6/c7-4-5(8)12-6-3(11-4)1-9-2-10-6/h1-2H,(H2,7,11)(H2,8,9,10,12) |
| InChIKey | PCPHNMZJBOYGSR-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 103.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.16 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze pteridine-6,7-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pteridine-6,7-diamine?
The IUPAC name of pteridine-6,7-diamine (CID 119097307) is pteridine-6,7-diamine.
What is the SMILES notation for pteridine-6,7-diamine?
The canonical SMILES for pteridine-6,7-diamine is Nc1nc2cncnc2nc1N.
What is the InChIKey of pteridine-6,7-diamine?
The InChIKey is PCPHNMZJBOYGSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N6/c7-4-5(8)12-6-3(11-4)1-9-2-10-6/h1-2H,(H2,7,11)(H2,8,9,10,12).
What are the key properties of pteridine-6,7-diamine?
pteridine-6,7-diamine has a molecular weight of 162.16 g/mol, XLogP of -0.42, 0 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for pteridine-6,7-diamine is sourced from PubChem (CID 119097307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).