About 7-chloropteridin-4-amine
7-chloropteridin-4-amine (PubChem CID 119097475) has the molecular formula C6H4ClN5
and a molecular weight of 181.59 g/mol. Its IUPAC name is 7-chloropteridin-4-amine.
Molecular Properties
| Compound Name | 7-chloropteridin-4-amine |
| PubChem CID | 119097475 |
| Molecular Formula | C6H4ClN5 |
| Molecular Weight | 181.59 g/mol |
| Exact Mass | 181.02 |
| IUPAC Name | 7-chloropteridin-4-amine |
| SMILES | Nc1ncnc2nc(Cl)cnc12 |
| InChI | InChI=1S/C6H4ClN5/c7-3-1-9-4-5(8)10-2-11-6(4)12-3/h1-2H,(H2,8,10,11,12) |
| InChIKey | IYWFDPOAZAPDRO-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 77.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.59 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 7-chloropteridin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloropteridin-4-amine?
The IUPAC name of 7-chloropteridin-4-amine (CID 119097475) is 7-chloropteridin-4-amine.
What is the SMILES notation for 7-chloropteridin-4-amine?
The canonical SMILES for 7-chloropteridin-4-amine is Nc1ncnc2nc(Cl)cnc12.
What is the InChIKey of 7-chloropteridin-4-amine?
The InChIKey is IYWFDPOAZAPDRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4ClN5/c7-3-1-9-4-5(8)10-2-11-6(4)12-3/h1-2H,(H2,8,10,11,12).
What are the key properties of 7-chloropteridin-4-amine?
7-chloropteridin-4-amine has a molecular weight of 181.59 g/mol, XLogP of 0.66, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloropteridin-4-amine is sourced from PubChem (CID 119097475), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).