About 1-ethylpyrimidin-2-imine
1-ethylpyrimidin-2-imine (PubChem CID 119098027) has the molecular formula C6H9N3
and a molecular weight of 123.16 g/mol. Its IUPAC name is 1-ethylpyrimidin-2-imine.
Molecular Properties
| Compound Name | 1-ethylpyrimidin-2-imine |
| PubChem CID | 119098027 |
| Molecular Formula | C6H9N3 |
| Molecular Weight | 123.16 g/mol |
| Exact Mass | 123.08 |
| IUPAC Name | 1-ethylpyrimidin-2-imine |
| SMILES | [H]/N=c1\ncccn1CC |
| InChI | InChI=1S/C6H9N3/c1-2-9-5-3-4-8-6(9)7/h3-5,7H,2H2,1H3/b7-6+ |
| InChIKey | HNNQIYXSTLIWEI-VOTSOKGWSA-N |
| XLogP | 0.38 |
| TPSA | 41.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 123.16 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-ethylpyrimidin-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethylpyrimidin-2-imine?
The IUPAC name of 1-ethylpyrimidin-2-imine (CID 119098027) is 1-ethylpyrimidin-2-imine.
What is the SMILES notation for 1-ethylpyrimidin-2-imine?
The canonical SMILES for 1-ethylpyrimidin-2-imine is [H]/N=c1\ncccn1CC.
What is the InChIKey of 1-ethylpyrimidin-2-imine?
The InChIKey is HNNQIYXSTLIWEI-VOTSOKGWSA-N. The full InChI is InChI=1S/C6H9N3/c1-2-9-5-3-4-8-6(9)7/h3-5,7H,2H2,1H3/b7-6+.
What are the key properties of 1-ethylpyrimidin-2-imine?
1-ethylpyrimidin-2-imine has a molecular weight of 123.16 g/mol, XLogP of 0.38, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethylpyrimidin-2-imine is sourced from PubChem (CID 119098027), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).