About 4-ethoxypyrimidine-2,5-diamine
4-ethoxypyrimidine-2,5-diamine (PubChem CID 119098064) has the molecular formula C6H10N4O
and a molecular weight of 154.17 g/mol. Its IUPAC name is 4-ethoxypyrimidine-2,5-diamine.
Molecular Properties
| Compound Name | 4-ethoxypyrimidine-2,5-diamine |
| PubChem CID | 119098064 |
| Molecular Formula | C6H10N4O |
| Molecular Weight | 154.17 g/mol |
| Exact Mass | 154.09 |
| IUPAC Name | 4-ethoxypyrimidine-2,5-diamine |
| SMILES | CCOc1nc(N)ncc1N |
| InChI | InChI=1S/C6H10N4O/c1-2-11-5-4(7)3-9-6(8)10-5/h3H,2,7H2,1H3,(H2,8,9,10) |
| InChIKey | BHCDXFWIVUSHDN-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 87.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.17 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-ethoxypyrimidine-2,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethoxypyrimidine-2,5-diamine?
The IUPAC name of 4-ethoxypyrimidine-2,5-diamine (CID 119098064) is 4-ethoxypyrimidine-2,5-diamine.
What is the SMILES notation for 4-ethoxypyrimidine-2,5-diamine?
The canonical SMILES for 4-ethoxypyrimidine-2,5-diamine is CCOc1nc(N)ncc1N.
What is the InChIKey of 4-ethoxypyrimidine-2,5-diamine?
The InChIKey is BHCDXFWIVUSHDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N4O/c1-2-11-5-4(7)3-9-6(8)10-5/h3H,2,7H2,1H3,(H2,8,9,10).
What are the key properties of 4-ethoxypyrimidine-2,5-diamine?
4-ethoxypyrimidine-2,5-diamine has a molecular weight of 154.17 g/mol, XLogP of 0.04, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethoxypyrimidine-2,5-diamine is sourced from PubChem (CID 119098064), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).