C17H27N2O4P — CID 11909881
ethyl (2S)-2-[(2S)-2-(diethylamino)-2-oxo-1,3,2λ5-oxazaphosphinan-3-yl]-2-phenylacetate (PubChem CID 11909881) has the molecular formula C17H27N2O4P and a molecular weight of 354.39 g/mol. Its IUPAC name is ethyl (2S)-2-[(2S)-2-(diethylamino)-2-oxo-1,3,2λ5-oxazaphosphinan-3-yl]-2-phenylacetate.
| Compound Name | ethyl (2S)-2-[(2S)-2-(diethylamino)-2-oxo-1,3,2λ5-oxazaphosphinan-3-yl]-2-phenylacetate |
|---|---|
| PubChem CID | 11909881 |
| Molecular Formula | C17H27N2O4P |
| Molecular Weight | 354.39 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | ethyl (2S)-2-[(2S)-2-(diethylamino)-2-oxo-1,3,2λ5-oxazaphosphinan-3-yl]-2-phenylacetate |
| SMILES | CCOC(=O)[C@H](c1ccccc1)N1CCCO[P@@]1(=O)N(CC)CC |
| InChI | InChI=1S/C17H27N2O4P/c1-4-18(5-2)24(21)19(13-10-14-23-24)16(17(20)22-6-3)15-11-8-7-9-12-15/h7-9,11-12,16H,4-6,10,13-14H2,1-3H3/t16-,24-/m0/s1 |
| InChIKey | GWVQSSGHEZPRSY-FYSMJZIKSA-N |
| XLogP | 3.46 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.39 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|