C6H5Cl6F — CID 119098816
1,2,3,4,5,6-hexachloro-1-fluorocyclohexane (PubChem CID 119098816) has the molecular formula C6H5Cl6F and a molecular weight of 308.82 g/mol. Its IUPAC name is 1,2,3,4,5,6-hexachloro-1-fluorocyclohexane.
| Compound Name | 1,2,3,4,5,6-hexachloro-1-fluorocyclohexane |
|---|---|
| PubChem CID | 119098816 |
| Molecular Formula | C6H5Cl6F |
| Molecular Weight | 308.82 g/mol |
| Exact Mass | 305.85 |
| IUPAC Name | 1,2,3,4,5,6-hexachloro-1-fluorocyclohexane |
| SMILES | FC1(Cl)C(Cl)C(Cl)C(Cl)C(Cl)C1Cl |
| InChI | InChI=1S/C6H5Cl6F/c7-1-2(8)4(10)6(12,13)5(11)3(1)9/h1-5H |
| InChIKey | RGCCTRMFPSOUQK-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.82 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|