About 5-bromo-1,3,6-trimethylpyridin-2-one
5-bromo-1,3,6-trimethylpyridin-2-one (PubChem CID 119098885) has the molecular formula C8H10BrNO
and a molecular weight of 216.08 g/mol. Its IUPAC name is 5-bromo-1,3,6-trimethylpyridin-2-one.
Molecular Properties
| Compound Name | 5-bromo-1,3,6-trimethylpyridin-2-one |
| PubChem CID | 119098885 |
| Molecular Formula | C8H10BrNO |
| Molecular Weight | 216.08 g/mol |
| Exact Mass | 214.99 |
| IUPAC Name | 5-bromo-1,3,6-trimethylpyridin-2-one |
| SMILES | Cc1cc(Br)c(C)n(C)c1=O |
| InChI | InChI=1S/C8H10BrNO/c1-5-4-7(9)6(2)10(3)8(5)11/h4H,1-3H3 |
| InChIKey | YIXLREAFYQOAAX-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.08 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-bromo-1,3,6-trimethylpyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-1,3,6-trimethylpyridin-2-one?
The IUPAC name of 5-bromo-1,3,6-trimethylpyridin-2-one (CID 119098885) is 5-bromo-1,3,6-trimethylpyridin-2-one.
What is the SMILES notation for 5-bromo-1,3,6-trimethylpyridin-2-one?
The canonical SMILES for 5-bromo-1,3,6-trimethylpyridin-2-one is Cc1cc(Br)c(C)n(C)c1=O.
What is the InChIKey of 5-bromo-1,3,6-trimethylpyridin-2-one?
The InChIKey is YIXLREAFYQOAAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10BrNO/c1-5-4-7(9)6(2)10(3)8(5)11/h4H,1-3H3.
What are the key properties of 5-bromo-1,3,6-trimethylpyridin-2-one?
5-bromo-1,3,6-trimethylpyridin-2-one has a molecular weight of 216.08 g/mol, XLogP of 1.76, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-1,3,6-trimethylpyridin-2-one is sourced from PubChem (CID 119098885), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).